CAS 2031260-41-8 appears in our catalog under these names: 1H,2H,3H-Naphtho(2,1-b)pyran-2-amine hydrochloride, 95%, 1H,2H,3H-Naphtho(2,1-b)pyran-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3-dihydro-1H-benzo[f]chromen-2-amine;hydrochloride (CAS 2031260-41-8) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 2,3-dihydro-1H-benzo[f]chromen-2-amine;hydrochloride. InChIKey: BPMOFVDTPPUWBW-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2,3-dihydro-1H-benzo[f]chromen-2-amine;hydrochloride |
| InChIKey | BPMOFVDTPPUWBW-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C3=CC=CC=C3C=C2)N.Cl |
Computed by PubChem (NCBI)