Products 203633-22-1
CAS 203633-22-1 appears in our catalog under these names: L–Lysine–d4 dihydrochloride, L-Lysine-d4 (dihydrochloride), 99.1%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 10 mg, 5 mg.
(2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride (CAS 203633-22-1) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 223.13 g/mol. IUPAC name: (2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-RGTYBCOQSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 223.13 g/mol |
| IUPAC name | (2S)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-RGTYBCOQSA-N |
| SMILES | [2H]C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])CN.Cl.Cl |
Computed by PubChem (NCBI)