Products 204315-20-8
CAS 204315-20-8 appears in our catalog under these names: Quinmerac metabolite BH 518-4, Quinmerac BH 518-4, Quinmerac BH 518-4, Concentration: 100 µg/ml Solvent: Acetone. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1x10mg, 1x1ml.
7-chloro-3-(hydroxymethyl)quinoline-8-carboxylic acid (CAS 204315-20-8) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 7-chloro-3-(hydroxymethyl)quinoline-8-carboxylic acid. InChIKey: JHTYXALVKFBXHL-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 7-chloro-3-(hydroxymethyl)quinoline-8-carboxylic acid |
| InChIKey | JHTYXALVKFBXHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C=C21)CO)C(=O)O)Cl |
Computed by PubChem (NCBI)