CAS 2045362-22-7 appears in our catalog under these names: (1S)-1-[4-(Difluoromethoxy)phenyl]ethan-1-amine hydrochloride, 95%, (S)–1–(4–(Difluoromethoxy)phenyl)ethan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-[4-(difluoromethoxy)phenyl]ethanamine;hydrochloride (CAS 2045362-22-7) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: (1S)-1-[4-(difluoromethoxy)phenyl]ethanamine;hydrochloride. InChIKey: BWXKCZGSVZCVQK-RGMNGODLSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (1S)-1-[4-(difluoromethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | BWXKCZGSVZCVQK-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC(F)F)N.Cl |
Computed by PubChem (NCBI)