CAS 1431968-06-7 is the registry number for 2-(2,2-Difluoroethoxy)-5-methylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2,2-difluoroethoxy)-5-methylaniline;hydrochloride (CAS 1431968-06-7) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)-5-methylaniline;hydrochloride. InChIKey: JEFAUDSIPUVLTC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)-5-methylaniline;hydrochloride |
| InChIKey | JEFAUDSIPUVLTC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(F)F)N.Cl |
Computed by PubChem (NCBI)