Products 1376321-29-7
CAS 1376321-29-7 is the registry number for 2-Amino-1-(3,4-difluorophenyl)propan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-(3,4-difluorophenyl)propan-1-ol;hydrochloride (CAS 1376321-29-7) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: 2-amino-1-(3,4-difluorophenyl)propan-1-ol;hydrochloride. InChIKey: JINOPQABKUPGCH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2-amino-1-(3,4-difluorophenyl)propan-1-ol;hydrochloride |
| InChIKey | JINOPQABKUPGCH-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC(=C(C=C1)F)F)O)N.Cl |
Computed by PubChem (NCBI)