CAS 2408966-09-4 appears in our catalog under these names: 2,2-Difluoro-2-(3-methoxyphenyl)ethan-1-amine hydrochloride, 97%, 2,2-Difluoro-2-(3-methoxyphenyl)ethan-1-amine (hydrochloride), 97%, 97%, 2,2-Difluoro-2-(3-methoxyphenyl)ethan-1-amine (hydrochloride), 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2,2-difluoro-2-(3-methoxyphenyl)ethanamine;hydrochloride (CAS 2408966-09-4) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: 2,2-difluoro-2-(3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: BMQSRVQGGOANQS-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2,2-difluoro-2-(3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | BMQSRVQGGOANQS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(CN)(F)F.Cl |
Computed by PubChem (NCBI)