CAS 1431965-01-3 is the registry number for 4-(2,2-Difluoroethoxy)-2-methylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(2,2-difluoroethoxy)-2-methylaniline;hydrochloride (CAS 1431965-01-3) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: 4-(2,2-difluoroethoxy)-2-methylaniline;hydrochloride. InChIKey: VREAQECTBMOQLW-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 4-(2,2-difluoroethoxy)-2-methylaniline;hydrochloride |
| InChIKey | VREAQECTBMOQLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(F)F)N.Cl |
Computed by PubChem (NCBI)