Products 1461705-44-1
CAS 1461705-44-1 is the registry number for 1-Amino-3-(2,4-difluorophenyl)propan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-amino-3-(2,4-difluorophenyl)propan-2-ol;hydrochloride (CAS 1461705-44-1) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: 1-amino-3-(2,4-difluorophenyl)propan-2-ol;hydrochloride. InChIKey: ZFNAQCBAWSQWQR-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 1-amino-3-(2,4-difluorophenyl)propan-2-ol;hydrochloride |
| InChIKey | ZFNAQCBAWSQWQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC(CN)O.Cl |
Computed by PubChem (NCBI)