CAS 1955474-81-3 appears in our catalog under these names: (2R)-1-(2,6-Difluorophenoxy)propan-2-amine hydrochloride, 95%, (2R)-1-(2,6-Difluorophenoxy)propan-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2R)-1-(2,6-difluorophenoxy)propan-2-amine;hydrochloride (CAS 1955474-81-3) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: (2R)-1-(2,6-difluorophenoxy)propan-2-amine;hydrochloride. InChIKey: SGAQZRJXPADIBT-FYZOBXCZSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (2R)-1-(2,6-difluorophenoxy)propan-2-amine;hydrochloride |
| InChIKey | SGAQZRJXPADIBT-FYZOBXCZSA-N |
| SMILES | C[C@H](COC1=C(C=CC=C1F)F)N.Cl |
Computed by PubChem (NCBI)