CAS 1955475-03-2 appears in our catalog under these names: (2S)-1-(2,6-Difluorophenoxy)propan-2-amine hydrochloride, (2S)-1-(2,6-Difluorophenoxy)propan-2-amine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
(2S)-1-(2,6-difluorophenoxy)propan-2-amine;hydrochloride (CAS 1955475-03-2) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: (2S)-1-(2,6-difluorophenoxy)propan-2-amine;hydrochloride. InChIKey: SGAQZRJXPADIBT-RGMNGODLSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (2S)-1-(2,6-difluorophenoxy)propan-2-amine;hydrochloride |
| InChIKey | SGAQZRJXPADIBT-RGMNGODLSA-N |
| SMILES | C[C@@H](COC1=C(C=CC=C1F)F)N.Cl |
Computed by PubChem (NCBI)