Products 205692-64-4

CAS 205692-64-4 is the registry number for 3-Methyl-5-methoxycarbonyl-4-piperidone hydrochloride, 99%. Offered by: Thermo Scientific (Acros). Available pack sizes: 500MG.

Structural formula: {0} (CAS {1})

Methyl 5-methyl-4-oxopiperidine-3-carboxylate;hydrochloride (CAS 205692-64-4) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: methyl 5-methyl-4-oxopiperidine-3-carboxylate;hydrochloride. InChIKey: JTZAAEGXSGIXFC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO3
Molecular weight207.65 g/mol
IUPAC namemethyl 5-methyl-4-oxopiperidine-3-carboxylate;hydrochloride
InChIKeyJTZAAEGXSGIXFC-UHFFFAOYSA-N
SMILESCC1CNCC(C1=O)C(=O)OC.Cl

Computed by PubChem (NCBI)