Products 207279-36-5

CAS 207279-36-5 is the registry number for Cyclopropanecarboxylic acid, 2-(4-chlorophenyl)-, ethyl ester, (1R,2R)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Trans-ethyl (1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylate (CAS 207279-36-5) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylate. InChIKey: MBJPATUIODMIKJ-WDEREUQCSA-N.

Identity
Molecular formulaC12H13ClO2
Molecular weight224.68 g/mol
IUPAC nametrans-ethyl (1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylate
InChIKeyMBJPATUIODMIKJ-WDEREUQCSA-N
SMILESCCOC(=O)[C@@H]1C[C@H]1C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)