CAS 345905-96-6 appears in our catalog under these names: Cyclopropanecarboxylic acid, 2-(4-chlorophenyl)-, ethyl ester, (1S,2S)-, 95%, 95%, CYCLOPROPANECARBOXYLIC ACID, 2-(4-CHLOROPHENYL)-, ETHYL ESTER, (1S,2S)-, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Trans-ethyl (1S,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylate (CAS 345905-96-6) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylate. InChIKey: MBJPATUIODMIKJ-MNOVXSKESA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylate |
| InChIKey | MBJPATUIODMIKJ-MNOVXSKESA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)