CAS 20771-97-5 is the registry number for 2-Chloro-6-formylbenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-6-formylbenzoic acid (CAS 20771-97-5) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 2-chloro-6-formylbenzoic acid. InChIKey: URGQYBULFKLFMX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 2-chloro-6-formylbenzoic acid |
| InChIKey | URGQYBULFKLFMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)C=O |
Computed by PubChem (NCBI)