Products 20776-66-3

CAS 20776-66-3 is the registry number for 2-Amino-3,6-dibromobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-amino-3,6-dibromobenzoic acid (CAS 20776-66-3) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2-amino-3,6-dibromobenzoic acid. InChIKey: SQZPTOHJOFPPLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2NO2
Molecular weight294.93 g/mol
IUPAC name2-amino-3,6-dibromobenzoic acid
InChIKeySQZPTOHJOFPPLZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1Br)C(=O)O)N)Br

Computed by PubChem (NCBI)