CAS 20776-66-3 is the registry number for 2-Amino-3,6-dibromobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-3,6-dibromobenzoic acid (CAS 20776-66-3) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2-amino-3,6-dibromobenzoic acid. InChIKey: SQZPTOHJOFPPLZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2-amino-3,6-dibromobenzoic acid |
| InChIKey | SQZPTOHJOFPPLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)C(=O)O)N)Br |
Computed by PubChem (NCBI)