CAS 208512-67-8 is the registry number for 6-Methyl-5-nitrobenzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-5-nitro-1,3-benzothiazole (CAS 208512-67-8) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 6-methyl-5-nitro-1,3-benzothiazole. InChIKey: QTXGOKQUSIKSMD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 6-methyl-5-nitro-1,3-benzothiazole |
| InChIKey | QTXGOKQUSIKSMD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1[N+](=O)[O-])N=CS2 |
Computed by PubChem (NCBI)