Products 2092678-51-6
CAS 2092678-51-6 appears in our catalog under these names: 1-(Trifluoromethyl)-1H-pyrazole-3-carboxylic acid, 97%, 97%, 1-(TRIFLUOROMETHYL)-1H-PYRAZOLE-3-CARBOXYLIC ACID, 97%. Offered by: Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
1-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 2092678-51-6) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 1-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: KTHBHWQFPDROPX-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 1-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | KTHBHWQFPDROPX-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)