CAS 2094024-41-4 appears in our catalog under these names: (1R,2S)-5-Aminocycloheptane-1,2-diol hydrochloride, 95%, rac(1R,2S)-5-Aminocycloheptane-1,2-diol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Cis-(1S,2R)-5-aminocycloheptane-1,2-diol;hydrochloride (CAS 2094024-41-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: cis-(1S,2R)-5-aminocycloheptane-1,2-diol;hydrochloride. InChIKey: ZNBVJIUUGVWIEB-FXFNDYDPSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | cis-(1S,2R)-5-aminocycloheptane-1,2-diol;hydrochloride |
| InChIKey | ZNBVJIUUGVWIEB-FXFNDYDPSA-N |
| SMILES | C1CC(CC[C@@H]([C@@H]1O)O)N.Cl |
Computed by PubChem (NCBI)