CAS 2095409-15-5 is the registry number for 7-​amino-2H-​1,​4-​benzothiazin-​3(4H)​-​one 1,​1-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-amino-1,1-dioxo-4H-1lambda6,4-benzothiazin-3-one;hydrochloride (CAS 2095409-15-5) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 7-amino-1,1-dioxo-4H-1lambda6,4-benzothiazin-3-one;hydrochloride. InChIKey: BMBLRLKXXYBNOI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3S |
|---|---|
| Molecular weight | 248.69 g/mol |
| IUPAC name | 7-amino-1,1-dioxo-4H-1lambda6,4-benzothiazin-3-one;hydrochloride |
| InChIKey | BMBLRLKXXYBNOI-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1(=O)=O)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)