CAS 2099064-90-9 appears in our catalog under these names: (3,4-Diaminophenyl)(4-(methyl(oxetan-3-yl)amino)phenyl)methanone, (3,4-Diaminophenyl)(4-(methyl(oxetan-3-yl)amino)phenyl)methanone, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3,4-diaminophenyl)-[4-[methyl(oxetan-3-yl)amino]phenyl]methanone (CAS 2099064-90-9) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: (3,4-diaminophenyl)-[4-[methyl(oxetan-3-yl)amino]phenyl]methanone. InChIKey: ZCOXPNPAMDHWGN-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | (3,4-diaminophenyl)-[4-[methyl(oxetan-3-yl)amino]phenyl]methanone |
| InChIKey | ZCOXPNPAMDHWGN-UHFFFAOYSA-N |
| SMILES | CN(C1COC1)C2=CC=C(C=C2)C(=O)C3=CC(=C(C=C3)N)N |
Computed by PubChem (NCBI)