CAS 2103968-61-0 is the registry number for 3-(3-bromo-2,6-difluorophenyl)oxetan-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(3-bromo-2,6-difluorophenyl)oxetan-3-ol (CAS 2103968-61-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 3-(3-bromo-2,6-difluorophenyl)oxetan-3-ol. InChIKey: CNPUZIWVSJLNKL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 3-(3-bromo-2,6-difluorophenyl)oxetan-3-ol |
| InChIKey | CNPUZIWVSJLNKL-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=C(C=CC(=C2F)Br)F)O |
Computed by PubChem (NCBI)