CAS 2105932-57-6 is the registry number for 3'-Formyl-4'-methoxy-[1,1'-biphenyl]-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3-formyl-4-methoxyphenyl)benzoic acid (CAS 2105932-57-6) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 4-(3-formyl-4-methoxyphenyl)benzoic acid. InChIKey: QXUNKRONUMTGRX-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 4-(3-formyl-4-methoxyphenyl)benzoic acid |
| InChIKey | QXUNKRONUMTGRX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=C(C=C2)C(=O)O)C=O |
Computed by PubChem (NCBI)