CAS 59210-61-6 appears in our catalog under these names: 4-Chloro-3-(dimethylsulfamoyl)benzoic acid, 95%, 4-Chloro-3-(N,N-dimethylsulfamoyl)benzoic acid, 97%, 4-Chloro-3-(dimethylsulfamoyl)benzoic acid, 4-Chloro-3-(dimethylsulfamoyl)benzoic acid, 97%, 97%, 4-Chloro-3-(dimethylsulfamoyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
4-chloro-3-(dimethylsulfamoyl)benzoic acid (CAS 59210-61-6) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 4-chloro-3-(dimethylsulfamoyl)benzoic acid. InChIKey: YMPQIPORTHDIJK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | 4-chloro-3-(dimethylsulfamoyl)benzoic acid |
| InChIKey | YMPQIPORTHDIJK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)