CAS 21228-43-3 appears in our catalog under these names: 7-Nitro-3,4-dihydrobenzo(f)(1,4)oxazepin-5(2H)-one, 95%, 7-Nitro-3,4-dihydro-1,4-benzoxazepin-5(2H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
7-nitro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CAS 21228-43-3) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 7-nitro-3,4-dihydro-2H-1,4-benzoxazepin-5-one. InChIKey: QKXGFMXLKHZJOV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| InChIKey | QKXGFMXLKHZJOV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)