Products 213594-43-5
CAS 213594-43-5 is the registry number for 1,6:3,4-Dianhydro-2-O-benzyl-β-D-altropyranose. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
5-phenylmethoxy-3,7,9-trioxatricyclo[4.2.1.02,4]nonane (CAS 213594-43-5) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 5-phenylmethoxy-3,7,9-trioxatricyclo[4.2.1.02,4]nonane. InChIKey: NFJVFOIZTWHLDY-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 5-phenylmethoxy-3,7,9-trioxatricyclo[4.2.1.02,4]nonane |
| InChIKey | NFJVFOIZTWHLDY-UHFFFAOYSA-N |
| SMILES | C1C2C3C(O3)C(C(O1)O2)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)