Products 2137794-19-3
CAS 2137794-19-3 is the registry number for 2-{3-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)phenoxy}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid (CAS 2137794-19-3) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid. InChIKey: KWMVNYHFOMORRZ-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid |
| InChIKey | KWMVNYHFOMORRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC(=CC=C4)OCC(=O)O |
Computed by PubChem (NCBI)