Products 2137924-34-4
CAS 2137924-34-4 is the registry number for 2-Bromo-5-hydroxy-4-(methoxymethoxy)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-hydroxy-4-(methoxymethoxy)benzaldehyde (CAS 2137924-34-4) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-bromo-5-hydroxy-4-(methoxymethoxy)benzaldehyde. InChIKey: HTULGWZODJEEAI-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-bromo-5-hydroxy-4-(methoxymethoxy)benzaldehyde |
| InChIKey | HTULGWZODJEEAI-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C=C(C(=C1)Br)C=O)O |
Computed by PubChem (NCBI)