CAS 2138371-15-8 is the registry number for 4-Chloro-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridin-6-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (CAS 2138371-15-8) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 4-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one. InChIKey: PFXHHOLXYZEPKK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| InChIKey | PFXHHOLXYZEPKK-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=O)N2)Cl)C |
Computed by PubChem (NCBI)