Products 2153-10-8
CAS 2153-10-8 is the registry number for 2,2-Dichloro-N-(4-hydroxyphenyl)acetamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,2-dichloro-N-(4-hydroxyphenyl)acetamide (CAS 2153-10-8) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2,2-dichloro-N-(4-hydroxyphenyl)acetamide. InChIKey: WIWSJWAXUVHJBW-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2,2-dichloro-N-(4-hydroxyphenyl)acetamide |
| InChIKey | WIWSJWAXUVHJBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)