CAS 216485-86-8 appears in our catalog under these names: 3–Isopropoxybenzeneboronic acid(Contains varying amounts of anhydride), 3-Isopropoxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Isopropoxyphenylboronic Acid, 98%, 98%, (3-Isopropoxyphenyl)boronic acid, 95%, 3-Isopropoxyphenylboronic acid, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g, 500g.
(3-propan-2-yloxyphenyl)boronic acid (CAS 216485-86-8) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (3-propan-2-yloxyphenyl)boronic acid. InChIKey: UKZVUHVNTYDSOP-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | UKZVUHVNTYDSOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC(C)C)(O)O |
Computed by PubChem (NCBI)