Products 2165565-11-5
CAS 2165565-11-5 is the registry number for (1S,2S)-2-(3-bromophenyl)cyclopropanecarboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1S,2S)-2-(3-bromophenyl)cyclopropane-1-carboxylic acid (CAS 2165565-11-5) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: trans-(1S,2S)-2-(3-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: WQKBKSZJAIBOED-BDAKNGLRSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | trans-(1S,2S)-2-(3-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WQKBKSZJAIBOED-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)