Products 91445-84-0
CAS 91445-84-0 appears in our catalog under these names: 2–(3–Bromophenyl)cyclopropanecarboxylic acid, 2-(3-Bromophenyl)cyclopropanecarboxylic acid, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-bromophenyl)cyclopropane-1-carboxylic acid (CAS 91445-84-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 2-(3-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: WQKBKSZJAIBOED-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 2-(3-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WQKBKSZJAIBOED-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)