Products 2168409-28-5
CAS 2168409-28-5 is the registry number for 2-bromo-4-chloro-3-methyl-1-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-1-chloro-2-methyl-4-(trifluoromethyl)benzene (CAS 2168409-28-5) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 3-bromo-1-chloro-2-methyl-4-(trifluoromethyl)benzene. InChIKey: RAEFOIMEILYHQG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 3-bromo-1-chloro-2-methyl-4-(trifluoromethyl)benzene |
| InChIKey | RAEFOIMEILYHQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Br)C(F)(F)F)Cl |
Computed by PubChem (NCBI)