Products 2174007-98-6
CAS 2174007-98-6 is the registry number for rac-(1R,5S)-3-Benzyl-3-azabicyclo(3.1.0)hexan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-amine;dihydrochloride (CAS 2174007-98-6) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: (1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-amine;dihydrochloride. InChIKey: YIMRCGQGFOSOGY-AQEKLAMFSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-amine;dihydrochloride |
| InChIKey | YIMRCGQGFOSOGY-AQEKLAMFSA-N |
| SMILES | C1[C@@H]2[C@]1(CN(C2)CC3=CC=CC=C3)N.Cl.Cl |
Computed by PubChem (NCBI)