Products 2181-84-2
CAS 2181-84-2 appears in our catalog under these names: Isopteleine, Isopteleine, 90.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 1 mg.
6-methoxy-9-methylfuro[2,3-b]quinolin-4-one (CAS 2181-84-2) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 6-methoxy-9-methylfuro[2,3-b]quinolin-4-one. InChIKey: XKTZVOMYVJKQTH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 6-methoxy-9-methylfuro[2,3-b]quinolin-4-one |
| InChIKey | XKTZVOMYVJKQTH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)OC)C(=O)C3=C1OC=C3 |
Computed by PubChem (NCBI)