CAS 219310-40-4 appears in our catalog under these names: 2,5-Dibromo-4-nitrotoluene, 95%, 2,5-Dibromo-4-nitrotoluene, 98%(GC-MS),RG, 1,4–Dibromo–2–methyl–5–nitrobenzene, 2,5-Dibromo-4-nitrotoluene, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Combi-blocks, Fluorochem, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
1,4-dibromo-2-methyl-5-nitrobenzene (CAS 219310-40-4) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1,4-dibromo-2-methyl-5-nitrobenzene. InChIKey: LEYVOWUJMKYDOV-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1,4-dibromo-2-methyl-5-nitrobenzene |
| InChIKey | LEYVOWUJMKYDOV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)