Products 219929-01-8
CAS 219929-01-8 is the registry number for MAC-5576. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5-chloro-3-pyridinyl) thiophene-2-carboxylate (CAS 219929-01-8) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: (5-chloro-3-pyridinyl) thiophene-2-carboxylate. InChIKey: PAVJYVVZIJTAHT-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | (5-chloro-3-pyridinyl) thiophene-2-carboxylate |
| InChIKey | PAVJYVVZIJTAHT-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)OC2=CC(=CN=C2)Cl |
Computed by PubChem (NCBI)