Products 220381-38-4
CAS 220381-38-4 appears in our catalog under these names: 9-Nitroanthracene-d9, >95% (HPLC), 9-Nitroanthracene-d9, 98 atom % D, min 98% Chemical Purity, 9–Nitroanthracene–d9, 9-Nitroanthracene-d9, 99.93%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 10mg, 1 mg, 5 mg.
1,2,3,4,5,6,7,8,9-nonadeuterio-10-nitroanthracene (CAS 220381-38-4) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 232.28 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9-nonadeuterio-10-nitroanthracene. InChIKey: LSIKFJXEYJIZNB-LOIXRAQWSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9-nonadeuterio-10-nitroanthracene |
| InChIKey | LSIKFJXEYJIZNB-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(=C(C(=C(C3=C2[N+](=O)[O-])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)