CAS 2219380-18-2 is the registry number for (6-Bromo-3,4-dihydro-2H-benzo(b)(1,4)oxazin-2-yl)methanol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride (CAS 2219380-18-2) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride. InChIKey: GSTZTWKNZWGNFS-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride |
| InChIKey | GSTZTWKNZWGNFS-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(N1)C=C(C=C2)Br)CO.Cl |
Computed by PubChem (NCBI)