CAS 22235-04-7 appears in our catalog under these names: 4-(Acetylamino)phthalic Anhydride, N–(1,3–Dioxo–1,3–dihydroisobenzofuran–5–yl)acetamide, 4-(Acetylamino)phthalic anhydride, min. 95 %, 100 mg, 4-(Acetylamino)phthalic anhydride, min. 95 %, 250 mg, 4-(Acetylamino)phthalic anhydride, min. 95 %, 500 mg. Offered by: TRC, GLPBio, Roth. Available pack sizes: 1g, 100mg, 250mg, 500mg.
N-(1,3-dioxo-2-benzofuran-5-yl)acetamide (CAS 22235-04-7) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: N-(1,3-dioxo-2-benzofuran-5-yl)acetamide. InChIKey: PFYOXMCPLCYYAQ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | N-(1,3-dioxo-2-benzofuran-5-yl)acetamide |
| InChIKey | PFYOXMCPLCYYAQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)