Products 22236-12-0
CAS 22236-12-0 appears in our catalog under these names: 1,3-Bis(difluoromethoxy)benzene 97%, 1,3-Bis(difluoromethoxy)benzene, 97%, 97%, 1,3-Bis(difluoromethoxy)benzene, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1,3-bis(difluoromethoxy)benzene (CAS 22236-12-0) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 1,3-bis(difluoromethoxy)benzene. InChIKey: WKUYZOKJVGOZNE-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 1,3-bis(difluoromethoxy)benzene |
| InChIKey | WKUYZOKJVGOZNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)OC(F)F |
Computed by PubChem (NCBI)