Products 2225173-92-0
CAS 2225173-92-0 is the registry number for 2–(iso–Propyl–d7)–6–cyanopyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-cyano-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-pyridinyl]boronic acid (CAS 2225173-92-0) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 197.05 g/mol. IUPAC name: [2-cyano-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-pyridinyl]boronic acid. InChIKey: GVVNMLAKDMPHOX-NWOXSKRJSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 197.05 g/mol |
| IUPAC name | [2-cyano-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-pyridinyl]boronic acid |
| InChIKey | GVVNMLAKDMPHOX-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC(=CC(=N1)C#N)B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)