Products 2225175-84-6
CAS 2225175-84-6 is the registry number for 2–(iso–Propyl)–6–cyanopyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-cyano-6-propan-2-yl-4-pyridinyl)boronic acid (CAS 2225175-84-6) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (2-cyano-6-propan-2-yl-4-pyridinyl)boronic acid. InChIKey: GVVNMLAKDMPHOX-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (2-cyano-6-propan-2-yl-4-pyridinyl)boronic acid |
| InChIKey | GVVNMLAKDMPHOX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)C(C)C)C#N)(O)O |
Computed by PubChem (NCBI)