CAS 2226829-32-7 is the registry number for 3,3,5,6-Tetrafluoroindolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3,5,6-tetrafluoro-1H-indol-2-one (CAS 2226829-32-7) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 3,3,5,6-tetrafluoro-1H-indol-2-one. InChIKey: AEXVXODGXMJAFM-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 3,3,5,6-tetrafluoro-1H-indol-2-one |
| InChIKey | AEXVXODGXMJAFM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC(=O)C2(F)F |
Computed by PubChem (NCBI)