Products 2227770-08-1
CAS 2227770-08-1 is the registry number for (S)-1-(2-Bromo-4-chlorophenyl)-2,2,2-trifluoroethan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol (CAS 2227770-08-1) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: (1S)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: KNGKJEAJYVSAIV-ZETCQYMHSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | (1S)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | KNGKJEAJYVSAIV-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)[C@@H](C(F)(F)F)O |
Computed by PubChem (NCBI)