Products 2228988-17-6
CAS 2228988-17-6 is the registry number for 1-(4-Bromo-2-methoxyphenyl)-2,2-difluoroethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-2-methoxyphenyl)-2,2-difluoroethanone (CAS 2228988-17-6) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 1-(4-bromo-2-methoxyphenyl)-2,2-difluoroethanone. InChIKey: HVJVTFXGPHLUGE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 1-(4-bromo-2-methoxyphenyl)-2,2-difluoroethanone |
| InChIKey | HVJVTFXGPHLUGE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)C(=O)C(F)F |
Computed by PubChem (NCBI)