Products 2241128-02-7
CAS 2241128-02-7 is the registry number for 2-{4-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)-2-hydroxyphenyl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-hydroxyphenyl]acetic acid (CAS 2241128-02-7) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-hydroxyphenyl]acetic acid. InChIKey: BJQWQABSKNDSTC-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-hydroxyphenyl]acetic acid |
| InChIKey | BJQWQABSKNDSTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC(=C(C=C4)CC(=O)O)O |
Computed by PubChem (NCBI)