Products 2243509-65-9

CAS 2243509-65-9 is the registry number for Methyl 4,4-difluoropiperidine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4,4-difluoropiperidine-2-carboxylate;hydrochloride (CAS 2243509-65-9) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl 4,4-difluoropiperidine-2-carboxylate;hydrochloride. InChIKey: RBRJTFVCUPBHAH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClF2NO2
Molecular weight215.62 g/mol
IUPAC namemethyl 4,4-difluoropiperidine-2-carboxylate;hydrochloride
InChIKeyRBRJTFVCUPBHAH-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(CCN1)(F)F.Cl

Computed by PubChem (NCBI)