Products 2243516-06-3
CAS 2243516-06-3 is the registry number for rac-(3aR,7aR)-Octahydropyrano(3,4-c)pyrrole-3a-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxylic acid;hydrochloride (CAS 2243516-06-3) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: (3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxylic acid;hydrochloride. InChIKey: HOKXNDTWCAQXGM-HNJRQZNRSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (3aS,7aS)-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-3a-carboxylic acid;hydrochloride |
| InChIKey | HOKXNDTWCAQXGM-HNJRQZNRSA-N |
| SMILES | C1COC[C@@]2([C@H]1CNC2)C(=O)O.Cl |
Computed by PubChem (NCBI)